Products 2923009-51-0
CAS 2923009-51-0 is the registry number for WRN inhibitor 13. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-cyclohexyl-N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-5-hydroxy-2-oxo-1H-pyridine-3-carboxamide (CAS 2923009-51-0) is a chemical compound with the molecular formula C16H20N2O5S and a molecular weight of 352.4 g/mol. IUPAC name: 6-cyclohexyl-N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-5-hydroxy-2-oxo-1H-pyridine-3-carboxamide. InChIKey: NVIXFLSBGMVBNO-NSHDSACASA-N.
| Molecular formula | C16H20N2O5S |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 6-cyclohexyl-N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-5-hydroxy-2-oxo-1H-pyridine-3-carboxamide |
| InChIKey | NVIXFLSBGMVBNO-NSHDSACASA-N |
| SMILES | C1CCC(CC1)C2=C(C=C(C(=O)N2)C(=O)N[C@@H]3CS(=O)(=O)C=C3)O |
Computed by PubChem (NCBI)
Synonyms:
WRN inhibitor 13, orb2945699