Products 713112-28-8
CAS 713112-28-8 is the registry number for 4-((4-(N,N-Diallylsulfamoyl)phenyl)amino)-4-oxobutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-[bis(prop-2-enyl)sulfamoyl]anilino]-4-oxobutanoic acid (CAS 713112-28-8) is a chemical compound with the molecular formula C16H20N2O5S and a molecular weight of 352.4 g/mol. IUPAC name: 4-[4-[bis(prop-2-enyl)sulfamoyl]anilino]-4-oxobutanoic acid. InChIKey: PLXIMHXWQYFVNK-UHFFFAOYSA-N.
| Molecular formula | C16H20N2O5S |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 4-[4-[bis(prop-2-enyl)sulfamoyl]anilino]-4-oxobutanoic acid |
| InChIKey | PLXIMHXWQYFVNK-UHFFFAOYSA-N |
| SMILES | C=CCN(CC=C)S(=O)(=O)C1=CC=C(C=C1)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)