CAS 2923861-55-4 is the registry number for 5-Benzyl 2-(tert-butyl) (R)-6-methyl-2,5,8-triazaspiro[3.5]nonane-2,5-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-O-benzyl 2-O-tert-butyl (6R)-6-methyl-2,5,8-triazaspiro[3.5]nonane-2,5-dicarboxylate (CAS 2923861-55-4) is a chemical compound with the molecular formula C20H29N3O4 and a molecular weight of 375.5 g/mol. IUPAC name: 5-O-benzyl 2-O-tert-butyl (6R)-6-methyl-2,5,8-triazaspiro[3.5]nonane-2,5-dicarboxylate. InChIKey: JUNQNOIWCVLFND-OAHLLOKOSA-N.
| Molecular formula | C20H29N3O4 |
|---|---|
| Molecular weight | 375.5 g/mol |
| IUPAC name | 5-O-benzyl 2-O-tert-butyl (6R)-6-methyl-2,5,8-triazaspiro[3.5]nonane-2,5-dicarboxylate |
| InChIKey | JUNQNOIWCVLFND-OAHLLOKOSA-N |
| SMILES | C[C@@H]1CNCC2(N1C(=O)OCC3=CC=CC=C3)CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)