Products 1160247-08-4

CAS 1160247-08-4 is the registry number for 9-Benzyl 2-tert-butyl 2,6,9-triazaspiro(4.5)decane-2,9-dicarboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.

9-O-benzyl 2-O-tert-butyl 2,6,9-triazaspiro[4.5]decane-2,9-dicarboxylate (CAS 1160247-08-4) is a chemical compound with the molecular formula C20H29N3O4 and a molecular weight of 375.5 g/mol. IUPAC name: 9-O-benzyl 2-O-tert-butyl 2,6,9-triazaspiro[4.5]decane-2,9-dicarboxylate. InChIKey: ONPXNIKYGMESAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H29N3O4
Molecular weight375.5 g/mol
IUPAC name9-O-benzyl 2-O-tert-butyl 2,6,9-triazaspiro[4.5]decane-2,9-dicarboxylate
InChIKeyONPXNIKYGMESAQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(C1)CN(CCN2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)