CAS 1160247-10-8 appears in our catalog under these names: 6-Benzyl 2-tert-butyl 2,6,9-triazaspiro[4.5]decane-2,6-dicarboxylate, 95%, 6-Benzyl 2-tert-butyl 2,6,9-triazaspiro-(4.5)decane-2,6-dicarboxylate, 97%, 6-Benzyl 2-tert-butyl 2,6,9-triazaspiro-[4.5]decane-2,6-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
6-O-benzyl 2-O-tert-butyl 2,6,9-triazaspiro[4.5]decane-2,6-dicarboxylate (CAS 1160247-10-8) is a chemical compound with the molecular formula C20H29N3O4 and a molecular weight of 375.5 g/mol. IUPAC name: 6-O-benzyl 2-O-tert-butyl 2,6,9-triazaspiro[4.5]decane-2,6-dicarboxylate. InChIKey: WBVPUSRPXQVDJC-UHFFFAOYSA-N.
| Molecular formula | C20H29N3O4 |
|---|---|
| Molecular weight | 375.5 g/mol |
| IUPAC name | 6-O-benzyl 2-O-tert-butyl 2,6,9-triazaspiro[4.5]decane-2,6-dicarboxylate |
| InChIKey | WBVPUSRPXQVDJC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CNCCN2C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)