CAS 2924183-52-6 is the registry number for 5S,6R-DiHETE Lactone. Offered by: TRC. Available pack sizes: 25mg.
(6R)-6-[(1R,3Z,6Z,9Z,12Z)-1-hydroxypentadeca-3,6,9,12-tetraenyl]oxan-2-one (CAS 2924183-52-6) is a chemical compound with the molecular formula C20H30O3 and a molecular weight of 318.4 g/mol. IUPAC name: (6R)-6-[(1R,3Z,6Z,9Z,12Z)-1-hydroxypentadeca-3,6,9,12-tetraenyl]oxan-2-one. InChIKey: HMMBXEDQZSAPEQ-ZGATWMQVSA-N.
| Molecular formula | C20H30O3 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (6R)-6-[(1R,3Z,6Z,9Z,12Z)-1-hydroxypentadeca-3,6,9,12-tetraenyl]oxan-2-one |
| InChIKey | HMMBXEDQZSAPEQ-ZGATWMQVSA-N |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C[C@H]([C@H]1CCCC(=O)O1)O |
Computed by PubChem (NCBI)