Products 2924824-44-0
CAS 2924824-44-0 is the registry number for 1-(3-Methoxy-4-methylphenyl)cyclopropan-1-amine hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
1-(3-methoxy-4-methylphenyl)cyclopropan-1-amine;hydrochloride (CAS 2924824-44-0) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 1-(3-methoxy-4-methylphenyl)cyclopropan-1-amine;hydrochloride. InChIKey: BAARGZJMWQSLRV-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 1-(3-methoxy-4-methylphenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | BAARGZJMWQSLRV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2(CC2)N)OC.Cl |
Computed by PubChem (NCBI)