CAS 2925078-29-9 is the registry number for CRBN ligand-379. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(8-bromoisoquinolin-5-yl)-1,3-diazinane-2,4-dione (CAS 2925078-29-9) is a chemical compound with the molecular formula C13H10BrN3O2 and a molecular weight of 320.14 g/mol. IUPAC name: 1-(8-bromoisoquinolin-5-yl)-1,3-diazinane-2,4-dione. InChIKey: MCNAORHAGKRFPM-UHFFFAOYSA-N.
| Molecular formula | C13H10BrN3O2 |
|---|---|
| Molecular weight | 320.14 g/mol |
| IUPAC name | 1-(8-bromoisoquinolin-5-yl)-1,3-diazinane-2,4-dione |
| InChIKey | MCNAORHAGKRFPM-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=C3C=CN=CC3=C(C=C2)Br |
Computed by PubChem (NCBI)