Products 2925091-82-1
CAS 2925091-82-1 is the registry number for CRBN ligand-420. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-(2,4-dioxo-1,3-diazinan-1-yl)quinoline-4-carbaldehyde (CAS 2925091-82-1) is a chemical compound with the molecular formula C14H11N3O3 and a molecular weight of 269.25 g/mol. IUPAC name: 8-(2,4-dioxo-1,3-diazinan-1-yl)quinoline-4-carbaldehyde. InChIKey: UYYCUAFDHMMRSM-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O3 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | 8-(2,4-dioxo-1,3-diazinan-1-yl)quinoline-4-carbaldehyde |
| InChIKey | UYYCUAFDHMMRSM-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC=CC3=C(C=CN=C32)C=O |
Computed by PubChem (NCBI)