CAS 2925095-42-5 appears in our catalog under these names: 3-(5-bromo-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)piperidine-2,6-dione, 97%, 97%, CRBN ligand-707, 99.53%. Offered by: Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 1g, 100 mg, 50 mg, 25 mg.
3-(5-bromo-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)piperidine-2,6-dione (CAS 2925095-42-5) is a chemical compound with the molecular formula C11H9BrN4O3 and a molecular weight of 325.12 g/mol. IUPAC name: 3-(5-bromo-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)piperidine-2,6-dione. InChIKey: IIXYHFCJBLVIIP-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN4O3 |
|---|---|
| Molecular weight | 325.12 g/mol |
| IUPAC name | 3-(5-bromo-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)piperidine-2,6-dione |
| InChIKey | IIXYHFCJBLVIIP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)N3C(=N2)C=CC=C3Br |
Computed by PubChem (NCBI)