CAS 2925101-51-3 is the registry number for CRBN ligand-879. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(7-bromo-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)piperidine-2,6-dione (CAS 2925101-51-3) is a chemical compound with the molecular formula C11H9BrN4O3 and a molecular weight of 325.12 g/mol. IUPAC name: 3-(7-bromo-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)piperidine-2,6-dione. InChIKey: YZEKNZCKZORYJR-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN4O3 |
|---|---|
| Molecular weight | 325.12 g/mol |
| IUPAC name | 3-(7-bromo-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)piperidine-2,6-dione |
| InChIKey | YZEKNZCKZORYJR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)N3C=CC(=CC3=N2)Br |
Computed by PubChem (NCBI)