CAS 2925479-98-5 is the registry number for 6,8-Difluoronaphthalen-1-yl trifluoromethanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(6,8-difluoronaphthalen-1-yl) trifluoromethanesulfonate (CAS 2925479-98-5) is a chemical compound with the molecular formula C11H5F5O3S and a molecular weight of 312.21 g/mol. IUPAC name: (6,8-difluoronaphthalen-1-yl) trifluoromethanesulfonate. InChIKey: BWAFJTNLMJGSDV-UHFFFAOYSA-N.
| Molecular formula | C11H5F5O3S |
|---|---|
| Molecular weight | 312.21 g/mol |
| IUPAC name | (6,8-difluoronaphthalen-1-yl) trifluoromethanesulfonate |
| InChIKey | BWAFJTNLMJGSDV-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2C(=C1)OS(=O)(=O)C(F)(F)F)F)F |
Computed by PubChem (NCBI)