CAS 2925480-03-9 is the registry number for 5,7-Difluoronaphthalen-1-yl trifluoromethanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5,7-difluoronaphthalen-1-yl) trifluoromethanesulfonate (CAS 2925480-03-9) is a chemical compound with the molecular formula C11H5F5O3S and a molecular weight of 312.21 g/mol. IUPAC name: (5,7-difluoronaphthalen-1-yl) trifluoromethanesulfonate. InChIKey: PPCWGMPVJHMKMB-UHFFFAOYSA-N.
| Molecular formula | C11H5F5O3S |
|---|---|
| Molecular weight | 312.21 g/mol |
| IUPAC name | (5,7-difluoronaphthalen-1-yl) trifluoromethanesulfonate |
| InChIKey | PPCWGMPVJHMKMB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2F)F)C(=C1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)