Products 2933217-32-2
CAS 2933217-32-2 is the registry number for 2-(tert-Butyl) 3-methyl (3S,5S)-6-oxo-2,7-diazaspiro[4.5]decane-2,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-O-tert-butyl 3-O-methyl (3S,5S)-6-oxo-2,7-diazaspiro[4.5]decane-2,3-dicarboxylate (CAS 2933217-32-2) is a chemical compound with the molecular formula C15H24N2O5 and a molecular weight of 312.36 g/mol. IUPAC name: 2-O-tert-butyl 3-O-methyl (3S,5S)-6-oxo-2,7-diazaspiro[4.5]decane-2,3-dicarboxylate. InChIKey: LOVDIUDXXMIHGG-BONVTDFDSA-N.
| Molecular formula | C15H24N2O5 |
|---|---|
| Molecular weight | 312.36 g/mol |
| IUPAC name | 2-O-tert-butyl 3-O-methyl (3S,5S)-6-oxo-2,7-diazaspiro[4.5]decane-2,3-dicarboxylate |
| InChIKey | LOVDIUDXXMIHGG-BONVTDFDSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@]2(CCCNC2=O)C[C@H]1C(=O)OC |
Computed by PubChem (NCBI)