CAS 959062-73-8 is the registry number for 8-(tert-Butyl) 4-methyl 2-oxo-1,8-diazaspiro(4.5)decane-4,8-dicarboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
8-O-tert-butyl 4-O-methyl 2-oxo-1,8-diazaspiro[4.5]decane-4,8-dicarboxylate (CAS 959062-73-8) is a chemical compound with the molecular formula C15H24N2O5 and a molecular weight of 312.36 g/mol. IUPAC name: 8-O-tert-butyl 4-O-methyl 2-oxo-1,8-diazaspiro[4.5]decane-4,8-dicarboxylate. InChIKey: LIJHSEFLUISMFM-UHFFFAOYSA-N.
| Molecular formula | C15H24N2O5 |
|---|---|
| Molecular weight | 312.36 g/mol |
| IUPAC name | 8-O-tert-butyl 4-O-methyl 2-oxo-1,8-diazaspiro[4.5]decane-4,8-dicarboxylate |
| InChIKey | LIJHSEFLUISMFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C(CC(=O)N2)C(=O)OC |
Computed by PubChem (NCBI)