Products 2225141-75-1

CAS 2225141-75-1 is the registry number for 2-tert-Butyl 5-ethyl 8-oxo-2,7-diazaspiro(3.5)nonane-2,5-dicarboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-O-tert-butyl 5-O-ethyl 8-oxo-2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate (CAS 2225141-75-1) is a chemical compound with the molecular formula C15H24N2O5 and a molecular weight of 312.36 g/mol. IUPAC name: 2-O-tert-butyl 5-O-ethyl 8-oxo-2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate. InChIKey: NYRNMKMYKGCXJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H24N2O5
Molecular weight312.36 g/mol
IUPAC name2-O-tert-butyl 5-O-ethyl 8-oxo-2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate
InChIKeyNYRNMKMYKGCXJQ-UHFFFAOYSA-N
SMILESCCOC(=O)C1CNC(=O)CC12CN(C2)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)