CAS 29346-20-1 appears in our catalog under these names: 2,3-Dihydroxy-5-(1-methylethyl)-2,4,6-cycloheptatrien-1-one, 2,3-DIHYDROXY-5-(1-METHYLETHYL)-2,4,6-CYCLOHEPTATRIEN-1-ONE, 97%, 2,4,6-cycloheptatrien-1-one, 2,3-dihydroxy-5-(1-methylethyl)-, 97%, 97%, 2,3-Dihydroxy-5-isopropylcyclohepta-2,4,6-trienone, 97%, 2,3–Dihydroxy–5–isopropylcyclohepta–2,4,6–trienone. Offered by: Biosynth, Fluorochem, Chemat, AmBeed, GLPBio. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg, 1g, 5g, 100 mg.
2,3-dihydroxy-6-propan-2-ylcyclohepta-2,4,6-trien-1-one (CAS 29346-20-1) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2,3-dihydroxy-6-propan-2-ylcyclohepta-2,4,6-trien-1-one. InChIKey: HVGNSPLLPQWYGC-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2,3-dihydroxy-6-propan-2-ylcyclohepta-2,4,6-trien-1-one |
| InChIKey | HVGNSPLLPQWYGC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=O)C(=C(C=C1)O)O |
Computed by PubChem (NCBI)