CAS 4356-35-8 appears in our catalog under these names: ß-Thujaplicinol/ 99.67% (existing batch purity), 2,3-Dihydroxy-5-isopropylcyclohepta-2,4,6-trienone, 2,7-DIHYDROXY-4-ISOPROPYLCYCLOHEPTA-2,4,6-TRIEN-1-ONE. Offered by: TargetMol, Biosynth, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
2,3-dihydroxy-6-propan-2-ylcyclohepta-2,4,6-trien-1-one (CAS 4356-35-8) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2,3-dihydroxy-6-propan-2-ylcyclohepta-2,4,6-trien-1-one. InChIKey: HVGNSPLLPQWYGC-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2,3-dihydroxy-6-propan-2-ylcyclohepta-2,4,6-trien-1-one |
| InChIKey | HVGNSPLLPQWYGC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=O)C(=C(C=C1)O)O |
Computed by PubChem (NCBI)