CAS 2936670-92-5 is the registry number for (S)-1-((2S,4S)-4-Fluoro-1-methylpyrrolidin-2-yl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]ethanol (CAS 2936670-92-5) is a chemical compound with the molecular formula C7H14FNO and a molecular weight of 147.19 g/mol. IUPAC name: (1S)-1-[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]ethanol. InChIKey: DIWHMZGAZWOSSH-ACZMJKKPSA-N.
| Molecular formula | C7H14FNO |
|---|---|
| Molecular weight | 147.19 g/mol |
| IUPAC name | (1S)-1-[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]ethanol |
| InChIKey | DIWHMZGAZWOSSH-ACZMJKKPSA-N |
| SMILES | C[C@@H]([C@@H]1C[C@@H](CN1C)F)O |
Computed by PubChem (NCBI)