CAS 2936671-13-3 is the registry number for Methyl 4,6-dichloro-5-methoxypyrimidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4,6-dichloro-5-methoxypyrimidine-2-carboxylate (CAS 2936671-13-3) is a chemical compound with the molecular formula C7H6Cl2N2O3 and a molecular weight of 237.04 g/mol. IUPAC name: methyl 4,6-dichloro-5-methoxypyrimidine-2-carboxylate. InChIKey: NAQRRGYEMBOSKV-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O3 |
|---|---|
| Molecular weight | 237.04 g/mol |
| IUPAC name | methyl 4,6-dichloro-5-methoxypyrimidine-2-carboxylate |
| InChIKey | NAQRRGYEMBOSKV-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(N=C1Cl)C(=O)OC)Cl |
Computed by PubChem (NCBI)