CAS 97137-15-0 is the registry number for (4,5-Dichloro-6-oxo-1,6-dihydropyridazin-1-yl)methyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(4,5-dichloro-6-oxopyridazin-1-yl)methyl acetate (CAS 97137-15-0) is a chemical compound with the molecular formula C7H6Cl2N2O3 and a molecular weight of 237.04 g/mol. IUPAC name: (4,5-dichloro-6-oxopyridazin-1-yl)methyl acetate. InChIKey: PJGXIBOVZVUVBO-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O3 |
|---|---|
| Molecular weight | 237.04 g/mol |
| IUPAC name | (4,5-dichloro-6-oxopyridazin-1-yl)methyl acetate |
| InChIKey | PJGXIBOVZVUVBO-UHFFFAOYSA-N |
| SMILES | CC(=O)OCN1C(=O)C(=C(C=N1)Cl)Cl |
Computed by PubChem (NCBI)