CAS 293750-55-7 is the registry number for Naphtho[1,2-b]furan-2,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzo[g][1]benzofuran-2,3-dione (CAS 293750-55-7) is a chemical compound with the molecular formula C12H6O3 and a molecular weight of 198.17 g/mol. IUPAC name: benzo[g][1]benzofuran-2,3-dione. InChIKey: YZMJNFYURJPOKU-UHFFFAOYSA-N.
| Molecular formula | C12H6O3 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | benzo[g][1]benzofuran-2,3-dione |
| InChIKey | YZMJNFYURJPOKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2OC(=O)C3=O |
Computed by PubChem (NCBI)