Products 716-39-2
CAS 716-39-2 appears in our catalog under these names: 2,3-Naphthalenedicarboxylic anhydride, 95%, 2,3-Naphthalic Anhydride, 2,3–Naphthalenedicarboxylic Anhydride, 2,3-Naphthalenedicarboxylic Anhydride, >95.0%(GC)(T), Naphtho[2,3-c]furan-1,3-dione, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Biosynth. Available pack sizes: 100g, 10g, 25g, 1g, 5g, 100mg, 50g, 250g.
Benzo[f][2]benzofuran-1,3-dione (CAS 716-39-2) is a chemical compound with the molecular formula C12H6O3 and a molecular weight of 198.17 g/mol. IUPAC name: benzo[f][2]benzofuran-1,3-dione. InChIKey: IZJDCINIYIMFGX-UHFFFAOYSA-N.
| Molecular formula | C12H6O3 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | benzo[f][2]benzofuran-1,3-dione |
| InChIKey | IZJDCINIYIMFGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C(=O)OC3=O |
Computed by PubChem (NCBI)
Synonyms:
naphtho[2,3-c]furan-1,3-dione, 2,3-Naphthalenedicarboxylic Anhydride, Naphtho(2,3-c)furan-1,3-dione, 2,3-naphthalic anhydride, benzo[f][2]benzofuran-1,3-dione, naphthalene-2,3-dicarboxylic anhydride, benzo[f]isobenzofuran-1,3-dione, 1H,3H-naphtho[2,3-c]furan-1,3-dione, 2,3-napthalenedicarboxylic anhydride, 2,3-napthalene dicarboxylic anhydride