Products 2937880-12-9
CAS 2937880-12-9 is the registry number for 2-(azetidin-3-yl)acetonitrile,4-methylbenzenesulfonic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2-(azetidin-3-yl)acetonitrile;4-methylbenzenesulfonic acid (CAS 2937880-12-9) is a chemical compound with the molecular formula C12H16N2O3S and a molecular weight of 268.33 g/mol. IUPAC name: 2-(azetidin-3-yl)acetonitrile;4-methylbenzenesulfonic acid. InChIKey: BDARELWNFLDRRU-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O3S |
|---|---|
| Molecular weight | 268.33 g/mol |
| IUPAC name | 2-(azetidin-3-yl)acetonitrile;4-methylbenzenesulfonic acid |
| InChIKey | BDARELWNFLDRRU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1C(CN1)CC#N |
Computed by PubChem (NCBI)