CAS 2938997-32-9 is the registry number for N-(5-Fluoro-2-methyl-4-nitrophenyl)benzamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
N-(5-fluoro-2-methyl-4-nitrophenyl)benzamide (CAS 2938997-32-9) is a chemical compound with the molecular formula C14H11FN2O3 and a molecular weight of 274.25 g/mol. IUPAC name: N-(5-fluoro-2-methyl-4-nitrophenyl)benzamide. InChIKey: NWQGIWUJCVEHOP-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2O3 |
|---|---|
| Molecular weight | 274.25 g/mol |
| IUPAC name | N-(5-fluoro-2-methyl-4-nitrophenyl)benzamide |
| InChIKey | NWQGIWUJCVEHOP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1NC(=O)C2=CC=CC=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)