CAS 339101-54-1 is the registry number for Methyl 3-[4-(fluoroanilino)carbonyl]isonicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Methyl 3-[(4-fluorophenyl)carbamoyl]pyridine-4-carboxylate (CAS 339101-54-1) is a chemical compound with the molecular formula C14H11FN2O3 and a molecular weight of 274.25 g/mol. IUPAC name: methyl 3-[(4-fluorophenyl)carbamoyl]pyridine-4-carboxylate. InChIKey: DJQFWZZEDRTVFZ-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2O3 |
|---|---|
| Molecular weight | 274.25 g/mol |
| IUPAC name | methyl 3-[(4-fluorophenyl)carbamoyl]pyridine-4-carboxylate |
| InChIKey | DJQFWZZEDRTVFZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=NC=C1)C(=O)NC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)