CAS 2940858-36-4 is the registry number for tert-Butyl ((3R,4S)-4-phenylpyrrolidin-3-yl)carbamate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Tert-butyl N-[(3R,4S)-4-phenylpyrrolidin-3-yl]carbamate;hydrochloride (CAS 2940858-36-4) is a chemical compound with the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-4-phenylpyrrolidin-3-yl]carbamate;hydrochloride. InChIKey: WGBYWHGKGNGNNX-KZCZEQIWSA-N.
| Molecular formula | C15H23ClN2O2 |
|---|---|
| Molecular weight | 298.81 g/mol |
| IUPAC name | tert-butyl N-[(3R,4S)-4-phenylpyrrolidin-3-yl]carbamate;hydrochloride |
| InChIKey | WGBYWHGKGNGNNX-KZCZEQIWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNC[C@@H]1C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)