Products 2940858-36-4

CAS 2940858-36-4 is the registry number for tert-Butyl ((3R,4S)-4-phenylpyrrolidin-3-yl)carbamate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(3R,4S)-4-phenylpyrrolidin-3-yl]carbamate;hydrochloride (CAS 2940858-36-4) is a chemical compound with the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-4-phenylpyrrolidin-3-yl]carbamate;hydrochloride. InChIKey: WGBYWHGKGNGNNX-KZCZEQIWSA-N.

Identity
Molecular formulaC15H23ClN2O2
Molecular weight298.81 g/mol
IUPAC nametert-butyl N-[(3R,4S)-4-phenylpyrrolidin-3-yl]carbamate;hydrochloride
InChIKeyWGBYWHGKGNGNNX-KZCZEQIWSA-N
SMILESCC(C)(C)OC(=O)N[C@H]1CNC[C@@H]1C2=CC=CC=C2.Cl

Computed by PubChem (NCBI)