Products 2940861-54-9

CAS 2940861-54-9 is the registry number for 2-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]ethanol,oxalic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

2-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]ethanol;oxalic acid (CAS 2940861-54-9) is a chemical compound with the molecular formula C9H15NO6 and a molecular weight of 233.22 g/mol. IUPAC name: 2-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]ethanol;oxalic acid. InChIKey: DPUKMZGVRPINTJ-LEUCUCNGSA-N.

Identity
Molecular formulaC9H15NO6
Molecular weight233.22 g/mol
IUPAC name2-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]ethanol;oxalic acid
InChIKeyDPUKMZGVRPINTJ-LEUCUCNGSA-N
SMILESC1[C@H]2CN([C@@H]1CO2)CCO.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)