CAS 62396-48-9 appears in our catalog under these names: (tert–Butoxycarbonyl)–D–aspartic acid, N-(tert-Butoxycarbonyl)-D-aspartic Acid, >98.0%(T), Boc-D-Asp-OH 97%, N-Boc-D-aspartic Acid, 97%, 97%, (tert-Butoxycarbonyl)-D-aspartic acid, 99.89%. Offered by: GLPBio, TCI, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 10g, 25 g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioic acid (CAS 62396-48-9) is a chemical compound with the molecular formula C9H15NO6 and a molecular weight of 233.22 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioic acid. InChIKey: KAJBMCZQVSQJDE-RXMQYKEDSA-N.
| Molecular formula | C9H15NO6 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioic acid |
| InChIKey | KAJBMCZQVSQJDE-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)