CAS 2940867-46-7 is the registry number for (3R,5R)-3,5-dimethylpiperazin-2-one,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(3R,5R)-3,5-dimethylpiperazin-2-one;hydrochloride (CAS 2940867-46-7) is a chemical compound with the molecular formula C6H13ClN2O and a molecular weight of 164.63 g/mol. IUPAC name: (3R,5R)-3,5-dimethylpiperazin-2-one;hydrochloride. InChIKey: VVLJWRYGOHFHBT-TYSVMGFPSA-N.
| Molecular formula | C6H13ClN2O |
|---|---|
| Molecular weight | 164.63 g/mol |
| IUPAC name | (3R,5R)-3,5-dimethylpiperazin-2-one;hydrochloride |
| InChIKey | VVLJWRYGOHFHBT-TYSVMGFPSA-N |
| SMILES | C[C@@H]1CNC(=O)[C@H](N1)C.Cl |
Computed by PubChem (NCBI)