Products 2940873-62-9
CAS 2940873-62-9 appears in our catalog under these names: (3S,5S)-3,5-Dimethylpiperazin-2-one hydrochloride, 98%, 98%, (3S,5S)-3,5-Dimethylpiperazin-2-one hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3S,5S)-3,5-dimethylpiperazin-2-one;hydrochloride (CAS 2940873-62-9) is a chemical compound with the molecular formula C6H13ClN2O and a molecular weight of 164.63 g/mol. IUPAC name: (3S,5S)-3,5-dimethylpiperazin-2-one;hydrochloride. InChIKey: VVLJWRYGOHFHBT-FHAQVOQBSA-N.
| Molecular formula | C6H13ClN2O |
|---|---|
| Molecular weight | 164.63 g/mol |
| IUPAC name | (3S,5S)-3,5-dimethylpiperazin-2-one;hydrochloride |
| InChIKey | VVLJWRYGOHFHBT-FHAQVOQBSA-N |
| SMILES | C[C@H]1CNC(=O)[C@@H](N1)C.Cl |
Computed by PubChem (NCBI)