Products 2940868-85-7
CAS 2940868-85-7 is the registry number for (2S)-2-acetamido-3-phenyl-propanoic acid,(3S,4R)-4-aminotetrahydropyran-3-ol, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g.
(2S)-2-acetamido-3-phenylpropanoic acid;(3S,4R)-4-aminooxan-3-ol (CAS 2940868-85-7) is a chemical compound with the molecular formula C16H24N2O5 and a molecular weight of 324.37 g/mol. IUPAC name: (2S)-2-acetamido-3-phenylpropanoic acid;(3S,4R)-4-aminooxan-3-ol. InChIKey: HRNVGNMMYDRTIK-RUFCYHGESA-N.
| Molecular formula | C16H24N2O5 |
|---|---|
| Molecular weight | 324.37 g/mol |
| IUPAC name | (2S)-2-acetamido-3-phenylpropanoic acid;(3S,4R)-4-aminooxan-3-ol |
| InChIKey | HRNVGNMMYDRTIK-RUFCYHGESA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O.C1COC[C@H]([C@@H]1N)O |
Computed by PubChem (NCBI)