Products 2940868-91-5
CAS 2940868-91-5 is the registry number for (3S,5S)-5-methoxypiperidin-3-amine,dihydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(3S,5S)-5-methoxypiperidin-3-amine;dihydrochloride (CAS 2940868-91-5) is a chemical compound with the molecular formula C6H16Cl2N2O and a molecular weight of 203.11 g/mol. IUPAC name: (3S,5S)-5-methoxypiperidin-3-amine;dihydrochloride. InChIKey: OYMMSUWUIIHPMM-USPAICOZSA-N.
| Molecular formula | C6H16Cl2N2O |
|---|---|
| Molecular weight | 203.11 g/mol |
| IUPAC name | (3S,5S)-5-methoxypiperidin-3-amine;dihydrochloride |
| InChIKey | OYMMSUWUIIHPMM-USPAICOZSA-N |
| SMILES | CO[C@H]1C[C@@H](CNC1)N.Cl.Cl |
Computed by PubChem (NCBI)