Products 2940870-69-7
CAS 2940870-69-7 is the registry number for 1-(tert-Butyl) 2-ethyl (2R,3R)-3-aminopiperidine-1,2-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-O-tert-butyl 2-O-ethyl (2R,3R)-3-aminopiperidine-1,2-dicarboxylate (CAS 2940870-69-7) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2R,3R)-3-aminopiperidine-1,2-dicarboxylate. InChIKey: SHSKHHYVYXBEKG-NXEZZACHSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2R,3R)-3-aminopiperidine-1,2-dicarboxylate |
| InChIKey | SHSKHHYVYXBEKG-NXEZZACHSA-N |
| SMILES | CCOC(=O)[C@H]1[C@@H](CCCN1C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)