Products 2940872-05-7
CAS 2940872-05-7 is the registry number for tert-butyl (3S,4S)-3-cyano-4-hydroxy-azepane-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Tert-butyl (3S,4S)-3-cyano-4-hydroxyazepane-1-carboxylate (CAS 2940872-05-7) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl (3S,4S)-3-cyano-4-hydroxyazepane-1-carboxylate. InChIKey: KPZGDQOYIJJKDH-ZJUUUORDSA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl (3S,4S)-3-cyano-4-hydroxyazepane-1-carboxylate |
| InChIKey | KPZGDQOYIJJKDH-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]([C@@H](C1)C#N)O |
Computed by PubChem (NCBI)