Products 2940876-70-8

CAS 2940876-70-8 is the registry number for (R)-1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid hydrobromide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

(8R)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid;hydrobromide (CAS 2940876-70-8) is a chemical compound with the molecular formula C7H12BrNO2S2 and a molecular weight of 286.2 g/mol. IUPAC name: (8R)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid;hydrobromide. InChIKey: DXALUCGGSBGKIY-NUBCRITNSA-N.

Identity
Molecular formulaC7H12BrNO2S2
Molecular weight286.2 g/mol
IUPAC name(8R)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid;hydrobromide
InChIKeyDXALUCGGSBGKIY-NUBCRITNSA-N
SMILESC1CSC2(S1)C[C@@H](NC2)C(=O)O.Br

Computed by PubChem (NCBI)