CAS 2940876-70-8 is the registry number for (R)-1,4-Dithia-7-azaspiro[4.4]nonane-8-carboxylic acid hydrobromide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
(8R)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid;hydrobromide (CAS 2940876-70-8) is a chemical compound with the molecular formula C7H12BrNO2S2 and a molecular weight of 286.2 g/mol. IUPAC name: (8R)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid;hydrobromide. InChIKey: DXALUCGGSBGKIY-NUBCRITNSA-N.
| Molecular formula | C7H12BrNO2S2 |
|---|---|
| Molecular weight | 286.2 g/mol |
| IUPAC name | (8R)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid;hydrobromide |
| InChIKey | DXALUCGGSBGKIY-NUBCRITNSA-N |
| SMILES | C1CSC2(S1)C[C@@H](NC2)C(=O)O.Br |
Computed by PubChem (NCBI)