CAS 75776-79-3 appears in our catalog under these names: 1,4-Dithia-7-azaspiro(4.4)nonane-8-carboxylic acid hydrobromide, 97%, (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid,hydrobromide, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g.
(8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid;hydrobromide (CAS 75776-79-3) is a chemical compound with the molecular formula C7H12BrNO2S2 and a molecular weight of 286.2 g/mol. IUPAC name: (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid;hydrobromide. InChIKey: DXALUCGGSBGKIY-JEDNCBNOSA-N.
| Molecular formula | C7H12BrNO2S2 |
|---|---|
| Molecular weight | 286.2 g/mol |
| IUPAC name | (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid;hydrobromide |
| InChIKey | DXALUCGGSBGKIY-JEDNCBNOSA-N |
| SMILES | C1CSC2(S1)C[C@H](NC2)C(=O)O.Br |
Computed by PubChem (NCBI)