CAS 2940876-83-3 is the registry number for trans-6,6-difluoro-3-azabicyclo[3.2.0]heptane,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(1R,5R)-6,6-difluoro-3-azabicyclo[3.2.0]heptane;hydrochloride (CAS 2940876-83-3) is a chemical compound with the molecular formula C6H10ClF2N and a molecular weight of 169.60 g/mol. IUPAC name: (1R,5R)-6,6-difluoro-3-azabicyclo[3.2.0]heptane;hydrochloride. InChIKey: NJBGNMIKAIZJQQ-FHAQVOQBSA-N.
| Molecular formula | C6H10ClF2N |
|---|---|
| Molecular weight | 169.60 g/mol |
| IUPAC name | (1R,5R)-6,6-difluoro-3-azabicyclo[3.2.0]heptane;hydrochloride |
| InChIKey | NJBGNMIKAIZJQQ-FHAQVOQBSA-N |
| SMILES | C1[C@H]2CNC[C@@H]2C1(F)F.Cl |
Computed by PubChem (NCBI)