Products 2940952-18-9
CAS 2940952-18-9 is the registry number for isopropyl 4-methyl-3-oxo-2-oxa-4-azabicyclo[3.1.1]heptane-5-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Propan-2-yl 4-methyl-3-oxo-2-oxa-4-azabicyclo[3.1.1]heptane-5-carboxylate (CAS 2940952-18-9) is a chemical compound with the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. IUPAC name: propan-2-yl 4-methyl-3-oxo-2-oxa-4-azabicyclo[3.1.1]heptane-5-carboxylate. InChIKey: BNKXSPWNLODUCW-UHFFFAOYSA-N.
| Molecular formula | C10H15NO4 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | propan-2-yl 4-methyl-3-oxo-2-oxa-4-azabicyclo[3.1.1]heptane-5-carboxylate |
| InChIKey | BNKXSPWNLODUCW-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C12CC(C1)OC(=O)N2C |
Computed by PubChem (NCBI)