Products 2940959-59-9
CAS 2940959-59-9 is the registry number for isopropyl 1,4-dimethyl-3-oxo-2-oxa-4-azabicyclo[3.1.1]heptane-5-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Propan-2-yl 1,4-dimethyl-3-oxo-2-oxa-4-azabicyclo[3.1.1]heptane-5-carboxylate (CAS 2940959-59-9) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: propan-2-yl 1,4-dimethyl-3-oxo-2-oxa-4-azabicyclo[3.1.1]heptane-5-carboxylate. InChIKey: ZXPVCSSSOGQKJD-UHFFFAOYSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | propan-2-yl 1,4-dimethyl-3-oxo-2-oxa-4-azabicyclo[3.1.1]heptane-5-carboxylate |
| InChIKey | ZXPVCSSSOGQKJD-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C12CC(C1)(OC(=O)N2C)C |
Computed by PubChem (NCBI)