Products 2941000-93-5
CAS 2941000-93-5 is the registry number for 2-(4-Amino-3,5-dimethylphenyl)propan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-amino-3,5-dimethylphenyl)propan-2-ol (CAS 2941000-93-5) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: 2-(4-amino-3,5-dimethylphenyl)propan-2-ol. InChIKey: YQQLHBJQJRXBCR-UHFFFAOYSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | 2-(4-amino-3,5-dimethylphenyl)propan-2-ol |
| InChIKey | YQQLHBJQJRXBCR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C)C(C)(C)O |
Computed by PubChem (NCBI)