Products 2944462-67-1
CAS 2944462-67-1 is the registry number for Tubulin inhibitor 33. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(1-methylindol-4-yl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazo[4,5-c]pyridine (CAS 2944462-67-1) is a chemical compound with the molecular formula C24H22N4O3 and a molecular weight of 414.5 g/mol. IUPAC name: 2-(1-methylindol-4-yl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazo[4,5-c]pyridine. InChIKey: LCQATVJMJZBCON-UHFFFAOYSA-N.
| Molecular formula | C24H22N4O3 |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | 2-(1-methylindol-4-yl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazo[4,5-c]pyridine |
| InChIKey | LCQATVJMJZBCON-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C(C=CC=C21)C3=NC4=C(N3)C=CN=C4C5=CC(=C(C(=C5)OC)OC)OC |
Computed by PubChem (NCBI)