CAS 294661-02-2 appears in our catalog under these names: 2,5-Dihydroxybenzoic Acid-D3, 2,5-Dihydroxybenzoic Acid-d3 (d2 Major), >95% (HPLC). Offered by: TRC. Available pack sizes: 1g, 50mg, 5mg.
2,4,5-trideuterio-3,6-dihydroxybenzoic acid (CAS 294661-02-2) is a chemical compound with the molecular formula C7H6O4 and a molecular weight of 157.14 g/mol. IUPAC name: 2,4,5-trideuterio-3,6-dihydroxybenzoic acid. InChIKey: WXTMDXOMEHJXQO-CBYSEHNBSA-N.
| Molecular formula | C7H6O4 |
|---|---|
| Molecular weight | 157.14 g/mol |
| IUPAC name | 2,4,5-trideuterio-3,6-dihydroxybenzoic acid |
| InChIKey | WXTMDXOMEHJXQO-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1O)[2H])C(=O)O)O)[2H] |
Computed by PubChem (NCBI)