CAS 294860-52-9 is the registry number for 5-(((1,1-Dimethylethyl)dimethylsilyl)oxy)-2(3H)-benzofuranone. Offered by: TRC. Available pack sizes: 500mg.
5-[tert-butyl(dimethyl)silyl]oxy-3H-1-benzofuran-2-one (CAS 294860-52-9) is a chemical compound with the molecular formula C14H20O3Si and a molecular weight of 264.39 g/mol. IUPAC name: 5-[tert-butyl(dimethyl)silyl]oxy-3H-1-benzofuran-2-one. InChIKey: DWPSSLUCHZJJLG-UHFFFAOYSA-N.
| Molecular formula | C14H20O3Si |
|---|---|
| Molecular weight | 264.39 g/mol |
| IUPAC name | 5-[tert-butyl(dimethyl)silyl]oxy-3H-1-benzofuran-2-one |
| InChIKey | DWPSSLUCHZJJLG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1)OC(=O)C2 |
Computed by PubChem (NCBI)