CAS 299912-77-9 appears in our catalog under these names: 6–((tert–butyldimethylsilyl)oxy)benzofuran–3(2H)–one, 6-((tert-Butyldimethylsilyl)oxy)benzofuran-3(2H)-one, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg.
6-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-3-one (CAS 299912-77-9) is a chemical compound with the molecular formula C14H20O3Si and a molecular weight of 264.39 g/mol. IUPAC name: 6-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-3-one. InChIKey: GINXPHDRULGHRQ-UHFFFAOYSA-N.
| Molecular formula | C14H20O3Si |
|---|---|
| Molecular weight | 264.39 g/mol |
| IUPAC name | 6-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-3-one |
| InChIKey | GINXPHDRULGHRQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1)C(=O)CO2 |
Computed by PubChem (NCBI)