Products 29528-26-5
CAS 29528-26-5 is the registry number for 2-(4,5-Dimethyl-1H-imidazol-2-yl)-phenylamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(4,5-dimethyl-1H-imidazol-2-yl)aniline (CAS 29528-26-5) is a chemical compound with the molecular formula C11H13N3 and a molecular weight of 187.24 g/mol. IUPAC name: 2-(4,5-dimethyl-1H-imidazol-2-yl)aniline. InChIKey: CJAIYRAOZOXQGX-UHFFFAOYSA-N.
| Molecular formula | C11H13N3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 2-(4,5-dimethyl-1H-imidazol-2-yl)aniline |
| InChIKey | CJAIYRAOZOXQGX-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N1)C2=CC=CC=C2N)C |
Computed by PubChem (NCBI)