Products 295345-31-2

CAS 295345-31-2 is the registry number for 4-Bromo-1H-1,2,3-triazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-bromo-2H-triazole-4-carboxylic acid (CAS 295345-31-2) is a chemical compound with the molecular formula C3H2BrN3O2 and a molecular weight of 191.97 g/mol. IUPAC name: 5-bromo-2H-triazole-4-carboxylic acid. InChIKey: GQELEICZNFTBLS-UHFFFAOYSA-N.

Identity
Molecular formulaC3H2BrN3O2
Molecular weight191.97 g/mol
IUPAC name5-bromo-2H-triazole-4-carboxylic acid
InChIKeyGQELEICZNFTBLS-UHFFFAOYSA-N
SMILESC1(=NNN=C1Br)C(=O)O

Computed by PubChem (NCBI)