Products 65902-59-2
CAS 65902-59-2 appears in our catalog under these names: 2-Bromo-4-nitroimidazole, 2-Bromo-5-nitroimidazole, 98% , 2-Bromo-4-nitroimidazole 97%, 2–Bromo–4–nitro–1H–imidazole, 2-Bromo-4-nitroimidazole, >98.0%(GC). Offered by: Biosynth, Thermo Scientific (Alfa Aesar), Ambeed, GLPBio, TCI. Available pack sizes: 100g, 250g, 500g, 1g, 5g, 10g, 25g.
2-bromo-5-nitro-1H-imidazole (CAS 65902-59-2) is a chemical compound with the molecular formula C3H2BrN3O2 and a molecular weight of 191.97 g/mol. IUPAC name: 2-bromo-5-nitro-1H-imidazole. InChIKey: UWRJWMLKEHRGOH-UHFFFAOYSA-N.
| Molecular formula | C3H2BrN3O2 |
|---|---|
| Molecular weight | 191.97 g/mol |
| IUPAC name | 2-bromo-5-nitro-1H-imidazole |
| InChIKey | UWRJWMLKEHRGOH-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=N1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)