Products 2955-23-9
CAS 2955-23-9 appears in our catalog under these names: Olivil, Olivil, 97.0%, Olivil, 97.5%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5 mg, 1 mg, 5mg.
(3R,4S,5R)-5-(4-hydroxy-3-methoxyphenyl)-3-[(4-hydroxy-3-methoxyphenyl)methyl]-4-(hydroxymethyl)oxolan-3-ol (CAS 2955-23-9) is a chemical compound with the molecular formula C20H24O7 and a molecular weight of 376.4 g/mol. IUPAC name: (3R,4S,5R)-5-(4-hydroxy-3-methoxyphenyl)-3-[(4-hydroxy-3-methoxyphenyl)methyl]-4-(hydroxymethyl)oxolan-3-ol. InChIKey: BVHIKUCXNBQDEM-GKCIPKSASA-N.
| Molecular formula | C20H24O7 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | (3R,4S,5R)-5-(4-hydroxy-3-methoxyphenyl)-3-[(4-hydroxy-3-methoxyphenyl)methyl]-4-(hydroxymethyl)oxolan-3-ol |
| InChIKey | BVHIKUCXNBQDEM-GKCIPKSASA-N |
| SMILES | COC1=C(C=CC(=C1)C[C@@]2(CO[C@H]([C@@H]2CO)C3=CC(=C(C=C3)O)OC)O)O |
Computed by PubChem (NCBI)