Products 2955579-45-8
CAS 2955579-45-8 is the registry number for tert-butyl 6-cyano-6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g.
Tert-butyl 6-cyano-6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate (CAS 2955579-45-8) is a chemical compound with the molecular formula C12H18N2O3 and a molecular weight of 238.28 g/mol. IUPAC name: tert-butyl 6-cyano-6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate. InChIKey: TXYMYCYMLUCFON-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O3 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | tert-butyl 6-cyano-6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate |
| InChIKey | TXYMYCYMLUCFON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(C2)(C#N)O |
Computed by PubChem (NCBI)